C22H21N3O3S — CID 2006886
(2E)-2-cyano-2-[(5R)-5-[(3,4-dimethylphenyl)methyl]-3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 2006886) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is (2E)-2-cyano-2-[(5R)-5-[(3,4-dimethylphenyl)methyl]-3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | (2E)-2-cyano-2-[(5R)-5-[(3,4-dimethylphenyl)methyl]-3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 2006886 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2E)-2-cyano-2-[(5R)-5-[(3,4-dimethylphenyl)methyl]-3-(3-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | COc1cccc(N2C(=O)[C@@H](Cc3ccc(C)c(C)c3)S/C2=C(\C#N)C(N)=O)c1 |
| InChI | InChI=1S/C22H21N3O3S/c1-13-7-8-15(9-14(13)2)10-19-21(27)25(16-5-4-6-17(11-16)28-3)22(29-19)18(12-23)20(24)26/h4-9,11,19H,10H2,1-3H3,(H2,24,26)/b22-18+/t19-/m1/s1 |
| InChIKey | SDQTVTDLVGOPQL-ODUYVQIQSA-N |
| XLogP | 3.22 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|