C20H16N4O5S — CID 3820435
2-cyano-2-[3-(3-methoxyphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 3820435) has the molecular formula C20H16N4O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is 2-cyano-2-[3-(3-methoxyphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | 2-cyano-2-[3-(3-methoxyphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 3820435 |
| Molecular Formula | C20H16N4O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-cyano-2-[3-(3-methoxyphenyl)-5-[(3-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | COc1cccc(N2C(=O)C(Cc3cccc([N+](=O)[O-])c3)SC2=C(C#N)C(N)=O)c1 |
| InChI | InChI=1S/C20H16N4O5S/c1-29-15-7-3-5-13(10-15)23-19(26)17(30-20(23)16(11-21)18(22)25)9-12-4-2-6-14(8-12)24(27)28/h2-8,10,17H,9H2,1H3,(H2,22,25) |
| InChIKey | SXDWRIXLBRUPNV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|