C20H16BrN3O2S — CID 4516863
2-[5-[(3-bromophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide (PubChem CID 4516863) has the molecular formula C20H16BrN3O2S and a molecular weight of 442.34 g/mol. Its IUPAC name is 2-[5-[(3-bromophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide.
| Compound Name | 2-[5-[(3-bromophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 4516863 |
| Molecular Formula | C20H16BrN3O2S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 2-[5-[(3-bromophenyl)methyl]-3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
| SMILES | Cc1ccc(N2C(=O)C(Cc3cccc(Br)c3)SC2=C(C#N)C(N)=O)cc1 |
| InChI | InChI=1S/C20H16BrN3O2S/c1-12-5-7-15(8-6-12)24-19(26)17(10-13-3-2-4-14(21)9-13)27-20(24)16(11-22)18(23)25/h2-9,17H,10H2,1H3,(H2,23,25) |
| InChIKey | YSQNYSICXMNQAO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|