C30H29N3O4S — CID 41066913
(2E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(5R)-5-[(2-methylphenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 41066913) has the molecular formula C30H29N3O4S and a molecular weight of 527.65 g/mol. Its IUPAC name is (2E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(5R)-5-[(2-methylphenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | (2E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(5R)-5-[(2-methylphenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 41066913 |
| Molecular Formula | C30H29N3O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | (2E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(5R)-5-[(2-methylphenyl)methyl]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C2/S[C@H](Cc3ccccc3C)C(=O)N2c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H29N3O4S/c1-20-9-7-8-10-22(20)18-27-29(35)33(23-11-5-4-6-12-23)30(38-27)24(19-31)28(34)32-16-15-21-13-14-25(36-2)26(17-21)37-3/h4-14,17,27H,15-16,18H2,1-3H3,(H,32,34)/b30-24+/t27-/m1/s1 |
| InChIKey | BFQILPCGOSDNKZ-OCLLKXGGSA-N |
| XLogP | 4.80 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|