C21H21N3OS — CID 2008904
7,7-dimethyl-2-phenyl-1-(pyridin-3-ylmethyl)-5,8-dihydropyrano[4,3-d]pyrimidine-4-thione (PubChem CID 2008904) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 7,7-dimethyl-2-phenyl-1-(pyridin-3-ylmethyl)-5,8-dihydropyrano[4,3-d]pyrimidine-4-thione.
| Compound Name | 7,7-dimethyl-2-phenyl-1-(pyridin-3-ylmethyl)-5,8-dihydropyrano[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 2008904 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 7,7-dimethyl-2-phenyl-1-(pyridin-3-ylmethyl)-5,8-dihydropyrano[4,3-d]pyrimidine-4-thione |
| SMILES | CC1(C)Cc2c(c(=S)nc(-c3ccccc3)n2Cc2cccnc2)CO1 |
| InChI | InChI=1S/C21H21N3OS/c1-21(2)11-18-17(14-25-21)20(26)23-19(16-8-4-3-5-9-16)24(18)13-15-7-6-10-22-12-15/h3-10,12H,11,13-14H2,1-2H3 |
| InChIKey | UYRSQSAGKUOXRO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|