C18H26N4OS2 — CID 2029353
12,12-dimethyl-3-piperazin-1-yl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene (PubChem CID 2029353) has the molecular formula C18H26N4OS2 and a molecular weight of 378.57 g/mol. Its IUPAC name is 12,12-dimethyl-3-piperazin-1-yl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene.
| Compound Name | 12,12-dimethyl-3-piperazin-1-yl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
|---|---|
| PubChem CID | 2029353 |
| Molecular Formula | C18H26N4OS2 |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 12,12-dimethyl-3-piperazin-1-yl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
| SMILES | CCCSc1nc(N2CCNCC2)c2c3c(sc2n1)COC(C)(C)C3 |
| InChI | InChI=1S/C18H26N4OS2/c1-4-9-24-17-20-15(22-7-5-19-6-8-22)14-12-10-18(2,3)23-11-13(12)25-16(14)21-17/h19H,4-11H2,1-3H3 |
| InChIKey | DGOHPCXBAKGGRO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |