C19H29N3O2S2 — CID 7707325
(2R)-2-[(5-butylsulfanyl-12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)amino]butan-1-ol (PubChem CID 7707325) has the molecular formula C19H29N3O2S2 and a molecular weight of 395.59 g/mol. Its IUPAC name is (2R)-2-[(5-butylsulfanyl-12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)amino]butan-1-ol.
| Compound Name | (2R)-2-[(5-butylsulfanyl-12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 7707325 |
| Molecular Formula | C19H29N3O2S2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (2R)-2-[(5-butylsulfanyl-12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)amino]butan-1-ol |
| SMILES | CCCCSc1nc(N[C@H](CC)CO)c2c3c(sc2n1)COC(C)(C)C3 |
| InChI | InChI=1S/C19H29N3O2S2/c1-5-7-8-25-18-21-16(20-12(6-2)10-23)15-13-9-19(3,4)24-11-14(13)26-17(15)22-18/h12,23H,5-11H2,1-4H3,(H,20,21,22)/t12-/m1/s1 |
| InChIKey | QMPAUPFKLPTXEZ-GFCCVEGCSA-N |
| XLogP | 4.62 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|