C19H26N4O3S2 — CID 74638284
butyl 2-[(12,12-dimethyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazinylidene]propanoate (PubChem CID 74638284) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is butyl 2-[(12,12-dimethyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazinylidene]propanoate.
| Compound Name | butyl 2-[(12,12-dimethyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 74638284 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | butyl 2-[(12,12-dimethyl-5-methylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazinylidene]propanoate |
| SMILES | CCCCOC(=O)C(C)=NNc1nc(SC)nc2sc3c(c12)CC(C)(C)OC3 |
| InChI | InChI=1S/C19H26N4O3S2/c1-6-7-8-25-17(24)11(2)22-23-15-14-12-9-19(3,4)26-10-13(12)28-16(14)21-18(20-15)27-5/h6-10H2,1-5H3,(H,20,21,23) |
| InChIKey | AGQGXIUOYWERFD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|