C21H24N2O4S — CID 2031948
ethyl 1-[(5Z)-5-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate (PubChem CID 2031948) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is ethyl 1-[(5Z)-5-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(5Z)-5-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2031948 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | ethyl 1-[(5Z)-5-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2=NC(=O)/C(=C/c3ccc4c(c3)C[C@@H](C)O4)S2)CC1 |
| InChI | InChI=1S/C21H24N2O4S/c1-3-26-20(25)15-6-8-23(9-7-15)21-22-19(24)18(28-21)12-14-4-5-17-16(11-14)10-13(2)27-17/h4-5,11-13,15H,3,6-10H2,1-2H3/b18-12-/t13-/m1/s1 |
| InChIKey | AZYQFHLTHQIGLV-FDIDITGRSA-N |
| XLogP | 3.26 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|