C22H24N2O4S — CID 19260617
ethyl 1-[(5Z)-5-[(2-methyl-2H-chromen-3-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate (PubChem CID 19260617) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is ethyl 1-[(5Z)-5-[(2-methyl-2H-chromen-3-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(5Z)-5-[(2-methyl-2H-chromen-3-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19260617 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethyl 1-[(5Z)-5-[(2-methyl-2H-chromen-3-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2=NC(=O)/C(=C/C3=Cc4ccccc4OC3C)S2)CC1 |
| InChI | InChI=1S/C22H24N2O4S/c1-3-27-21(26)15-8-10-24(11-9-15)22-23-20(25)19(29-22)13-17-12-16-6-4-5-7-18(16)28-14(17)2/h4-7,12-15H,3,8-11H2,1-2H3/b19-13- |
| InChIKey | AIYYISNTXBKWIR-UYRXBGFRSA-N |
| XLogP | 3.64 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|