C20H25N3O5S — CID 4893261
ethyl 1-[5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate (PubChem CID 4893261) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is ethyl 1-[5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4893261 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | ethyl 1-[5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2=NC(=O)C(=Cc3ccc(N4CCOCC4)o3)S2)CC1 |
| InChI | InChI=1S/C20H25N3O5S/c1-2-27-19(25)14-5-7-23(8-6-14)20-21-18(24)16(29-20)13-15-3-4-17(28-15)22-9-11-26-12-10-22/h3-4,13-14H,2,5-12H2,1H3 |
| InChIKey | AXELTXBZXMJRHA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|