C22H17Cl2N4O2S- — CID 2032383
[3-(3,4-dichloroanilino)quinoxalin-2-yl]-(3,4-dimethylphenyl)sulfonylazanide (PubChem CID 2032383) has the molecular formula C22H17Cl2N4O2S- and a molecular weight of 472.38 g/mol. Its IUPAC name is [3-(3,4-dichloroanilino)quinoxalin-2-yl]-(3,4-dimethylphenyl)sulfonylazanide.
| Compound Name | [3-(3,4-dichloroanilino)quinoxalin-2-yl]-(3,4-dimethylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 2032383 |
| Molecular Formula | C22H17Cl2N4O2S- |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | [3-(3,4-dichloroanilino)quinoxalin-2-yl]-(3,4-dimethylphenyl)sulfonylazanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]c2nc3ccccc3nc2Nc2ccc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C22H17Cl2N4O2S/c1-13-7-9-16(11-14(13)2)31(29,30)28-22-21(25-15-8-10-17(23)18(24)12-15)26-19-5-3-4-6-20(19)27-22/h3-12H,1-2H3,(H-,25,26,27,28)/q-1 |
| InChIKey | XIDMEBLFWRSHGA-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |