C27H30ClN7O3S — CID 59249045
[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]-[5-[[dimethylamino(dimethylazaniumylidene)methyl]amino]-2-methylphenyl]sulfonylazanide (PubChem CID 59249045) has the molecular formula C27H30ClN7O3S and a molecular weight of 568.10 g/mol. Its IUPAC name is [3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]-[5-[[dimethylamino(dimethylazaniumylidene)methyl]amino]-2-methylphenyl]sulfonylazanide.
| Compound Name | [3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]-[5-[[dimethylamino(dimethylazaniumylidene)methyl]amino]-2-methylphenyl]sulfonylazanide |
|---|---|
| PubChem CID | 59249045 |
| Molecular Formula | C27H30ClN7O3S |
| Molecular Weight | 568.10 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | [3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]-[5-[[dimethylamino(dimethylazaniumylidene)methyl]amino]-2-methylphenyl]sulfonylazanide |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2[N-]S(=O)(=O)c2cc(NC(N(C)C)=[N+](C)C)ccc2C)c1 |
| InChI | InChI=1S/C27H29ClN7O3S/c1-17-11-12-18(29-27(34(2)3)35(4)5)15-24(17)39(36,37)33-26-25(30-21-9-7-8-10-22(21)31-26)32-23-16-19(38-6)13-14-20(23)28/h7-16H,1-6H3,(H-,30,31,32,33)/q-1/p+1 |
| InChIKey | PJCNJFXLKMSVKJ-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.10 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|