C27H31ClN7O3S+ — CID 57448676
[[3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]-4-methylanilino]-(dimethylamino)methylidene]-dimethylazanium (PubChem CID 57448676) has the molecular formula C27H31ClN7O3S+ and a molecular weight of 569.11 g/mol. Its IUPAC name is [[3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]-4-methylanilino]-(dimethylamino)methylidene]-dimethylazanium.
| Compound Name | [[3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]-4-methylanilino]-(dimethylamino)methylidene]-dimethylazanium |
|---|---|
| PubChem CID | 57448676 |
| Molecular Formula | C27H31ClN7O3S+ |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | [[3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]-4-methylanilino]-(dimethylamino)methylidene]-dimethylazanium |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2cc(NC(N(C)C)=[N+](C)C)ccc2C)c1 |
| InChI | InChI=1S/C27H30ClN7O3S/c1-17-11-12-18(29-27(34(2)3)35(4)5)15-24(17)39(36,37)33-26-25(30-21-9-7-8-10-22(21)31-26)32-23-16-19(38-6)13-14-20(23)28/h7-16H,1-6H3,(H2,30,31,32,33)/p+1 |
| InChIKey | OWBIPCLPQLTEBE-UHFFFAOYSA-O |
| XLogP | 4.75 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|