C26H19ClN2O5 — CID 2039177
2-(4-chlorophenyl)-8-methoxy-3-[(4-methoxyphenyl)methyl]chromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 2039177) has the molecular formula C26H19ClN2O5 and a molecular weight of 474.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-8-methoxy-3-[(4-methoxyphenyl)methyl]chromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 2-(4-chlorophenyl)-8-methoxy-3-[(4-methoxyphenyl)methyl]chromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 2039177 |
| Molecular Formula | C26H19ClN2O5 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-(4-chlorophenyl)-8-methoxy-3-[(4-methoxyphenyl)methyl]chromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | COc1ccc(Cn2c(-c3ccc(Cl)cc3)nc3oc4cc(OC)ccc4c(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C26H19ClN2O5/c1-32-18-9-3-15(4-10-18)14-29-24(16-5-7-17(27)8-6-16)28-25-22(26(29)31)23(30)20-12-11-19(33-2)13-21(20)34-25/h3-13H,14H2,1-2H3 |
| InChIKey | GJGQAIHAJFQMCV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|