C24H18N2O5 — CID 666565
2-(furan-2-yl)-3-[2-(4-methoxyphenyl)ethyl]chromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 666565) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-(furan-2-yl)-3-[2-(4-methoxyphenyl)ethyl]chromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 2-(furan-2-yl)-3-[2-(4-methoxyphenyl)ethyl]chromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 666565 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-(furan-2-yl)-3-[2-(4-methoxyphenyl)ethyl]chromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | COc1ccc(CCn2c(-c3ccco3)nc3oc4ccccc4c(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C24H18N2O5/c1-29-16-10-8-15(9-11-16)12-13-26-22(19-7-4-14-30-19)25-23-20(24(26)28)21(27)17-5-2-3-6-18(17)31-23/h2-11,14H,12-13H2,1H3 |
| InChIKey | YEOSJUQIOOPCHR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|