C21H18N2O4 — CID 2040325
8-methoxy-2-methyl-3-(2-phenylethyl)chromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 2040325) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 8-methoxy-2-methyl-3-(2-phenylethyl)chromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 8-methoxy-2-methyl-3-(2-phenylethyl)chromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 2040325 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 8-methoxy-2-methyl-3-(2-phenylethyl)chromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | COc1ccc2c(=O)c3c(=O)n(CCc4ccccc4)c(C)nc3oc2c1 |
| InChI | InChI=1S/C21H18N2O4/c1-13-22-20-18(19(24)16-9-8-15(26-2)12-17(16)27-20)21(25)23(13)11-10-14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | ZMHARAMFPJJACT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|