C24H15BrN2O3 — CID 2036957
3-benzyl-2-(3-bromophenyl)chromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 2036957) has the molecular formula C24H15BrN2O3 and a molecular weight of 459.30 g/mol. Its IUPAC name is 3-benzyl-2-(3-bromophenyl)chromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 3-benzyl-2-(3-bromophenyl)chromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 2036957 |
| Molecular Formula | C24H15BrN2O3 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 3-benzyl-2-(3-bromophenyl)chromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | O=c1c2ccccc2oc2nc(-c3cccc(Br)c3)n(Cc3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C24H15BrN2O3/c25-17-10-6-9-16(13-17)22-26-23-20(21(28)18-11-4-5-12-19(18)30-23)24(29)27(22)14-15-7-2-1-3-8-15/h1-13H,14H2 |
| InChIKey | WBCVDQGKGUFQGU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|