C12H23NO — CID 20501091
2,2-dimethyl-1-azaspiro[5.5]undecan-4-ol (PubChem CID 20501091) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2,2-dimethyl-1-azaspiro[5.5]undecan-4-ol.
| Compound Name | 2,2-dimethyl-1-azaspiro[5.5]undecan-4-ol |
|---|---|
| PubChem CID | 20501091 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2,2-dimethyl-1-azaspiro[5.5]undecan-4-ol |
| SMILES | CC1(C)CC(O)CC2(CCCCC2)N1 |
| InChI | InChI=1S/C12H23NO/c1-11(2)8-10(14)9-12(13-11)6-4-3-5-7-12/h10,13-14H,3-9H2,1-2H3 |
| InChIKey | KQFLQICIXFFTQZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |