C22H32N4O5S2 — CID 20504604
N-[2-[4-(cyclohexylsulfanylcarbamoylsulfamoyl)phenyl]ethyl]-4-methyl-2-oxopiperidine-1-carboxamide (PubChem CID 20504604) has the molecular formula C22H32N4O5S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylsulfanylcarbamoylsulfamoyl)phenyl]ethyl]-4-methyl-2-oxopiperidine-1-carboxamide.
| Compound Name | N-[2-[4-(cyclohexylsulfanylcarbamoylsulfamoyl)phenyl]ethyl]-4-methyl-2-oxopiperidine-1-carboxamide |
|---|---|
| PubChem CID | 20504604 |
| Molecular Formula | C22H32N4O5S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[2-[4-(cyclohexylsulfanylcarbamoylsulfamoyl)phenyl]ethyl]-4-methyl-2-oxopiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NSC3CCCCC3)cc2)C(=O)C1 |
| InChI | InChI=1S/C22H32N4O5S2/c1-16-12-14-26(20(27)15-16)22(29)23-13-11-17-7-9-19(10-8-17)33(30,31)25-21(28)24-32-18-5-3-2-4-6-18/h7-10,16,18H,2-6,11-15H2,1H3,(H,23,29)(H2,24,25,28) |
| InChIKey | ARNHPAORRQXAII-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|