C24H32N4O4S — CID 21389104
N-[2-[4-[(4-methylpiperidin-1-yl)carbamoylsulfamoyl]phenyl]ethyl]-3-phenylpropanamide (PubChem CID 21389104) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[2-[4-[(4-methylpiperidin-1-yl)carbamoylsulfamoyl]phenyl]ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-[4-[(4-methylpiperidin-1-yl)carbamoylsulfamoyl]phenyl]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 21389104 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[2-[4-[(4-methylpiperidin-1-yl)carbamoylsulfamoyl]phenyl]ethyl]-3-phenylpropanamide |
| SMILES | CC1CCN(NC(=O)NS(=O)(=O)c2ccc(CCNC(=O)CCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H32N4O4S/c1-19-14-17-28(18-15-19)26-24(30)27-33(31,32)22-10-7-21(8-11-22)13-16-25-23(29)12-9-20-5-3-2-4-6-20/h2-8,10-11,19H,9,12-18H2,1H3,(H,25,29)(H2,26,27,30) |
| InChIKey | ILJNGEPRVBYFBZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |