C12H26O3Si2 — CID 20515749
trimethylsilyl 2-ethyl-1-trimethylsilyloxycyclopropane-1-carboxylate (PubChem CID 20515749) has the molecular formula C12H26O3Si2 and a molecular weight of 274.51 g/mol. Its IUPAC name is trimethylsilyl 2-ethyl-1-trimethylsilyloxycyclopropane-1-carboxylate.
| Compound Name | trimethylsilyl 2-ethyl-1-trimethylsilyloxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 20515749 |
| Molecular Formula | C12H26O3Si2 |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | trimethylsilyl 2-ethyl-1-trimethylsilyloxycyclopropane-1-carboxylate |
| SMILES | CCC1CC1(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C12H26O3Si2/c1-8-10-9-12(10,15-17(5,6)7)11(13)14-16(2,3)4/h10H,8-9H2,1-7H3 |
| InChIKey | BMHFKIKNICICIR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|