C17H23Cl2N3O4 — CID 20516696
2-[[3-[(2,2-dichloro-1-methylcyclopropyl)methoxy]phenyl]carbamoyl-methylamino]ethyl N-methylcarbamate (PubChem CID 20516696) has the molecular formula C17H23Cl2N3O4 and a molecular weight of 404.29 g/mol. Its IUPAC name is 2-[[3-[(2,2-dichloro-1-methylcyclopropyl)methoxy]phenyl]carbamoyl-methylamino]ethyl N-methylcarbamate.
| Compound Name | 2-[[3-[(2,2-dichloro-1-methylcyclopropyl)methoxy]phenyl]carbamoyl-methylamino]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 20516696 |
| Molecular Formula | C17H23Cl2N3O4 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[[3-[(2,2-dichloro-1-methylcyclopropyl)methoxy]phenyl]carbamoyl-methylamino]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCN(C)C(=O)Nc1cccc(OCC2(C)CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C17H23Cl2N3O4/c1-16(10-17(16,18)19)11-26-13-6-4-5-12(9-13)21-14(23)22(3)7-8-25-15(24)20-2/h4-6,9H,7-8,10-11H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | QUQSQNDXXSVBFN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|