C12H5Cl3N4O4S — CID 20519685
1-(4-nitrophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile (PubChem CID 20519685) has the molecular formula C12H5Cl3N4O4S and a molecular weight of 407.62 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile.
| Compound Name | 1-(4-nitrophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 20519685 |
| Molecular Formula | C12H5Cl3N4O4S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 405.91 |
| IUPAC Name | 1-(4-nitrophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(-c2ccc([N+](=O)[O-])cc2)c(=O)n(SC(Cl)(Cl)Cl)c1=O |
| InChI | InChI=1S/C12H5Cl3N4O4S/c13-12(14,15)24-18-10(20)7(5-16)6-17(11(18)21)8-1-3-9(4-2-8)19(22)23/h1-4,6H |
| InChIKey | AAZNZLVJSRHFFY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|