C15H10Cl3N3O2S — CID 20519707
1-(4-cyclopropylphenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile (PubChem CID 20519707) has the molecular formula C15H10Cl3N3O2S and a molecular weight of 402.69 g/mol. Its IUPAC name is 1-(4-cyclopropylphenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile.
| Compound Name | 1-(4-cyclopropylphenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 20519707 |
| Molecular Formula | C15H10Cl3N3O2S |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 1-(4-cyclopropylphenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(-c2ccc(C3CC3)cc2)c(=O)n(SC(Cl)(Cl)Cl)c1=O |
| InChI | InChI=1S/C15H10Cl3N3O2S/c16-15(17,18)24-21-13(22)11(7-19)8-20(14(21)23)12-5-3-10(4-6-12)9-1-2-9/h3-6,8-9H,1-2H2 |
| InChIKey | IRGGXUOKPLLHLA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|