C32H28N4O5 — CID 20522505
methyl 2-[3-azido-2-[3,4-bis(phenylmethoxy)phenyl]-4-oxoazetidin-1-yl]-2-phenylacetate (PubChem CID 20522505) has the molecular formula C32H28N4O5 and a molecular weight of 548.60 g/mol. Its IUPAC name is methyl 2-[3-azido-2-[3,4-bis(phenylmethoxy)phenyl]-4-oxoazetidin-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[3-azido-2-[3,4-bis(phenylmethoxy)phenyl]-4-oxoazetidin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 20522505 |
| Molecular Formula | C32H28N4O5 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | methyl 2-[3-azido-2-[3,4-bis(phenylmethoxy)phenyl]-4-oxoazetidin-1-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)N1C(=O)C(N=[N+]=[N-])C1c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H28N4O5/c1-39-32(38)30(24-15-9-4-10-16-24)36-29(28(31(36)37)34-35-33)25-17-18-26(40-20-22-11-5-2-6-12-22)27(19-25)41-21-23-13-7-3-8-14-23/h2-19,28-30H,20-21H2,1H3 |
| InChIKey | BPQJIINPELPWTG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 113.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|