C26H28N4O6 — CID 137456520
(3S,4S)-3-azido-4-(4-methoxy-3-phenylmethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-ol (PubChem CID 137456520) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is (3S,4S)-3-azido-4-(4-methoxy-3-phenylmethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-ol.
| Compound Name | (3S,4S)-3-azido-4-(4-methoxy-3-phenylmethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-ol |
|---|---|
| PubChem CID | 137456520 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (3S,4S)-3-azido-4-(4-methoxy-3-phenylmethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-ol |
| SMILES | COc1ccc([C@H]2[C@H](N=[N+]=[N-])C(O)N2c2cc(OC)c(OC)c(OC)c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H28N4O6/c1-32-19-11-10-17(12-20(19)36-15-16-8-6-5-7-9-16)24-23(28-29-27)26(31)30(24)18-13-21(33-2)25(35-4)22(14-18)34-3/h5-14,23-24,26,31H,15H2,1-4H3/t23-,24-,26?/m0/s1 |
| InChIKey | UEMBQQDJCXIOJC-OKHNBNEASA-N |
| XLogP | 4.86 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|