C15H21ClO2S — CID 20523115
1-(4-chlorobutan-2-yl)-6,7-dimethoxy-3,4-dihydro-1H-isothiochromene (PubChem CID 20523115) has the molecular formula C15H21ClO2S and a molecular weight of 300.85 g/mol. Its IUPAC name is 1-(4-chlorobutan-2-yl)-6,7-dimethoxy-3,4-dihydro-1H-isothiochromene.
| Compound Name | 1-(4-chlorobutan-2-yl)-6,7-dimethoxy-3,4-dihydro-1H-isothiochromene |
|---|---|
| PubChem CID | 20523115 |
| Molecular Formula | C15H21ClO2S |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-(4-chlorobutan-2-yl)-6,7-dimethoxy-3,4-dihydro-1H-isothiochromene |
| SMILES | COc1cc2c(cc1OC)C(C(C)CCCl)SCC2 |
| InChI | InChI=1S/C15H21ClO2S/c1-10(4-6-16)15-12-9-14(18-3)13(17-2)8-11(12)5-7-19-15/h8-10,15H,4-7H2,1-3H3 |
| InChIKey | COOMLGMYEUMTTD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|