C16H23ClO2S — CID 70540873
1-(4-chlorobutan-2-yl)-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzothiepine (PubChem CID 70540873) has the molecular formula C16H23ClO2S and a molecular weight of 314.88 g/mol. Its IUPAC name is 1-(4-chlorobutan-2-yl)-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzothiepine.
| Compound Name | 1-(4-chlorobutan-2-yl)-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzothiepine |
|---|---|
| PubChem CID | 70540873 |
| Molecular Formula | C16H23ClO2S |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-(4-chlorobutan-2-yl)-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzothiepine |
| SMILES | COc1cc2c(cc1OC)C(C(C)CCCl)SCCC2 |
| InChI | InChI=1S/C16H23ClO2S/c1-11(6-7-17)16-13-10-15(19-3)14(18-2)9-12(13)5-4-8-20-16/h9-11,16H,4-8H2,1-3H3 |
| InChIKey | OUTKKSCZWKHOOQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|