C18H28ClNO2 — CID 20526820
N-(butoxymethyl)-2-chloro-3,3-dimethyl-N-(2-methylphenyl)butanamide (PubChem CID 20526820) has the molecular formula C18H28ClNO2 and a molecular weight of 325.88 g/mol. Its IUPAC name is N-(butoxymethyl)-2-chloro-3,3-dimethyl-N-(2-methylphenyl)butanamide.
| Compound Name | N-(butoxymethyl)-2-chloro-3,3-dimethyl-N-(2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 20526820 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-(butoxymethyl)-2-chloro-3,3-dimethyl-N-(2-methylphenyl)butanamide |
| SMILES | CCCCOCN(C(=O)C(Cl)C(C)(C)C)c1ccccc1C |
| InChI | InChI=1S/C18H28ClNO2/c1-6-7-12-22-13-20(15-11-9-8-10-14(15)2)17(21)16(19)18(3,4)5/h8-11,16H,6-7,12-13H2,1-5H3 |
| InChIKey | JMNHVDNYCHVOAD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|