C13H7Cl5OS2 — CID 20531867
hydroxy-[4-methyl-2-(2,3,4,5,6-pentachlorophenyl)phenyl]-sulfanylidene-λ4-sulfane (PubChem CID 20531867) has the molecular formula C13H7Cl5OS2 and a molecular weight of 420.60 g/mol. Its IUPAC name is hydroxy-[4-methyl-2-(2,3,4,5,6-pentachlorophenyl)phenyl]-sulfanylidene-λ4-sulfane.
| Compound Name | hydroxy-[4-methyl-2-(2,3,4,5,6-pentachlorophenyl)phenyl]-sulfanylidene-λ4-sulfane |
|---|---|
| PubChem CID | 20531867 |
| Molecular Formula | C13H7Cl5OS2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 417.84 |
| IUPAC Name | hydroxy-[4-methyl-2-(2,3,4,5,6-pentachlorophenyl)phenyl]-sulfanylidene-λ4-sulfane |
| SMILES | Cc1ccc(S(O)=S)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H7Cl5OS2/c1-5-2-3-7(21(19)20)6(4-5)8-9(14)11(16)13(18)12(17)10(8)15/h2-4H,1H3,(H,19,20) |
| InChIKey | RYYHDPQILYSQAL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|