About 2-thiaspiro[4.4]nonane
2-thiaspiro[4.4]nonane (PubChem CID 20542465) has the molecular formula C8H14S
and a molecular weight of 142.27 g/mol. Its IUPAC name is 2-thiaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-thiaspiro[4.4]nonane |
| PubChem CID | 20542465 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 2-thiaspiro[4.4]nonane |
| SMILES | C1CCC2(C1)CCSC2 |
| InChI | InChI=1S/C8H14S/c1-2-4-8(3-1)5-6-9-7-8/h1-7H2 |
| InChIKey | YLHHOTTWWILDKP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-thiaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiaspiro[4.4]nonane?
The IUPAC name of 2-thiaspiro[4.4]nonane (CID 20542465) is 2-thiaspiro[4.4]nonane.
What is the SMILES notation for 2-thiaspiro[4.4]nonane?
The canonical SMILES for 2-thiaspiro[4.4]nonane is C1CCC2(C1)CCSC2.
What is the InChIKey of 2-thiaspiro[4.4]nonane?
The InChIKey is YLHHOTTWWILDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S/c1-2-4-8(3-1)5-6-9-7-8/h1-7H2.
What are the key properties of 2-thiaspiro[4.4]nonane?
2-thiaspiro[4.4]nonane has a molecular weight of 142.27 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiaspiro[4.4]nonane is sourced from PubChem (CID 20542465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).