C30H57N3O2 — CID 20543073
1-[4-[2-[2-[1-(1-hydroxyethyl)-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-4-yl]ethylamino]ethyl]-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-1-yl]ethanol (PubChem CID 20543073) has the molecular formula C30H57N3O2 and a molecular weight of 491.81 g/mol. Its IUPAC name is 1-[4-[2-[2-[1-(1-hydroxyethyl)-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-4-yl]ethylamino]ethyl]-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-1-yl]ethanol.
| Compound Name | 1-[4-[2-[2-[1-(1-hydroxyethyl)-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-4-yl]ethylamino]ethyl]-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-1-yl]ethanol |
|---|---|
| PubChem CID | 20543073 |
| Molecular Formula | C30H57N3O2 |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 491.45 |
| IUPAC Name | 1-[4-[2-[2-[1-(1-hydroxyethyl)-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-4-yl]ethylamino]ethyl]-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-1-yl]ethanol |
| SMILES | CC(O)N1C2CCCCC2C(CCNCCC2CC(C)(C)N(C(C)O)C3CCCCC23)CC1(C)C |
| InChI | InChI=1S/C30H57N3O2/c1-21(34)32-27-13-9-7-11-25(27)23(19-29(32,3)4)15-17-31-18-16-24-20-30(5,6)33(22(2)35)28-14-10-8-12-26(24)28/h21-28,31,34-35H,7-20H2,1-6H3 |
| InChIKey | BREVNEHIXSPVLR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|