C28H29FN4O3S — CID 20553039
2-butylsulfanyl-4-[4-[[2-(4-fluorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]pyrimidine (PubChem CID 20553039) has the molecular formula C28H29FN4O3S and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-butylsulfanyl-4-[4-[[2-(4-fluorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]pyrimidine.
| Compound Name | 2-butylsulfanyl-4-[4-[[2-(4-fluorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]pyrimidine |
|---|---|
| PubChem CID | 20553039 |
| Molecular Formula | C28H29FN4O3S |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 2-butylsulfanyl-4-[4-[[2-(4-fluorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]pyrimidine |
| SMILES | CCCCSc1nccc(-c2ccc(OCC3COC(Cn4ccnc4)(c4ccc(F)cc4)O3)cc2)n1 |
| InChI | InChI=1S/C28H29FN4O3S/c1-2-3-16-37-27-31-13-12-26(32-27)21-4-10-24(11-5-21)34-17-25-18-35-28(36-25,19-33-15-14-30-20-33)22-6-8-23(29)9-7-22/h4-15,20,25H,2-3,16-19H2,1H3 |
| InChIKey | MORLVFTXFJGHFJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|