C21H24N4O3 — CID 2055444
(5R,5aS)-5-[4-(dimethylamino)phenyl]-1,3-dimethyl-5a,7,8,9-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 2055444) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is (5R,5aS)-5-[4-(dimethylamino)phenyl]-1,3-dimethyl-5a,7,8,9-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | (5R,5aS)-5-[4-(dimethylamino)phenyl]-1,3-dimethyl-5a,7,8,9-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 2055444 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (5R,5aS)-5-[4-(dimethylamino)phenyl]-1,3-dimethyl-5a,7,8,9-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | CN(C)c1ccc([C@@H]2c3c(n(C)c(=O)n(C)c3=O)N=C3CCCC(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-23(2)13-10-8-12(9-11-13)16-17-14(6-5-7-15(17)26)22-19-18(16)20(27)25(4)21(28)24(19)3/h8-11,16-17H,5-7H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | ZVHJLRCVBBVSNZ-IRXDYDNUSA-N |
| XLogP | 1.74 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|