C14H6F5N3O7 — CID 20554520
2-[2,6-difluoro-4-(trifluoromethoxy)anilino]-3,5-dinitrobenzoic acid (PubChem CID 20554520) has the molecular formula C14H6F5N3O7 and a molecular weight of 423.21 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(trifluoromethoxy)anilino]-3,5-dinitrobenzoic acid.
| Compound Name | 2-[2,6-difluoro-4-(trifluoromethoxy)anilino]-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 20554520 |
| Molecular Formula | C14H6F5N3O7 |
| Molecular Weight | 423.21 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 2-[2,6-difluoro-4-(trifluoromethoxy)anilino]-3,5-dinitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Nc1c(F)cc(OC(F)(F)F)cc1F |
| InChI | InChI=1S/C14H6F5N3O7/c15-8-3-6(29-14(17,18)19)4-9(16)12(8)20-11-7(13(23)24)1-5(21(25)26)2-10(11)22(27)28/h1-4,20H,(H,23,24) |
| InChIKey | MPQVAPRPJBIQJT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|