C13H17N2O+ — CID 2055611
2-cyanoethyl-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]azanium (PubChem CID 2055611) has the molecular formula C13H17N2O+ and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-cyanoethyl-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]azanium.
| Compound Name | 2-cyanoethyl-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 2055611 |
| Molecular Formula | C13H17N2O+ |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-cyanoethyl-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]azanium |
| SMILES | N#CCC[NH2+]C[C@@H]1OCCc2ccccc21 |
| InChI | InChI=1S/C13H16N2O/c14-7-3-8-15-10-13-12-5-2-1-4-11(12)6-9-16-13/h1-2,4-5,13,15H,3,6,8-10H2/p+1/t13-/m0/s1 |
| InChIKey | QKGMGTWUQWSKBN-ZDUSSCGKSA-O |
| XLogP | 0.78 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|