C14H20NO+ — CID 5220641
3,4-dihydro-1H-isochromen-1-ylmethyl(2-methylprop-2-enyl)azanium (PubChem CID 5220641) has the molecular formula C14H20NO+ and a molecular weight of 218.32 g/mol. Its IUPAC name is 3,4-dihydro-1H-isochromen-1-ylmethyl(2-methylprop-2-enyl)azanium.
| Compound Name | 3,4-dihydro-1H-isochromen-1-ylmethyl(2-methylprop-2-enyl)azanium |
|---|---|
| PubChem CID | 5220641 |
| Molecular Formula | C14H20NO+ |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3,4-dihydro-1H-isochromen-1-ylmethyl(2-methylprop-2-enyl)azanium |
| SMILES | C=C(C)C[NH2+]CC1OCCc2ccccc21 |
| InChI | InChI=1S/C14H19NO/c1-11(2)9-15-10-14-13-6-4-3-5-12(13)7-8-16-14/h3-6,14-15H,1,7-10H2,2H3/p+1 |
| InChIKey | GTSIPQNNVZDQNP-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|