C15H23BrN2 — CID 20556386
2-N-(4-bromophenyl)-1-N,1-N-dimethylcycloheptane-1,2-diamine (PubChem CID 20556386) has the molecular formula C15H23BrN2 and a molecular weight of 311.27 g/mol. Its IUPAC name is 2-N-(4-bromophenyl)-1-N,1-N-dimethylcycloheptane-1,2-diamine.
| Compound Name | 2-N-(4-bromophenyl)-1-N,1-N-dimethylcycloheptane-1,2-diamine |
|---|---|
| PubChem CID | 20556386 |
| Molecular Formula | C15H23BrN2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-N-(4-bromophenyl)-1-N,1-N-dimethylcycloheptane-1,2-diamine |
| SMILES | CN(C)C1CCCCCC1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H23BrN2/c1-18(2)15-7-5-3-4-6-14(15)17-13-10-8-12(16)9-11-13/h8-11,14-15,17H,3-7H2,1-2H3 |
| InChIKey | WFURWZACXGSYMO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |