C19H24 — CID 20558537
1-methyl-4-[[3-(2-methylbutan-2-yl)phenyl]methyl]benzene (PubChem CID 20558537) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-methyl-4-[[3-(2-methylbutan-2-yl)phenyl]methyl]benzene.
| Compound Name | 1-methyl-4-[[3-(2-methylbutan-2-yl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 20558537 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1-methyl-4-[[3-(2-methylbutan-2-yl)phenyl]methyl]benzene |
| SMILES | CCC(C)(C)c1cccc(Cc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C19H24/c1-5-19(3,4)18-8-6-7-17(14-18)13-16-11-9-15(2)10-12-16/h6-12,14H,5,13H2,1-4H3 |
| InChIKey | YAICROGFWJWQII-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |