C22H28 — CID 145399611
1-(2,3-dimethylpent-1-en-3-yl)-2-methyl-4-[(4-methylphenyl)methyl]benzene (PubChem CID 145399611) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-(2,3-dimethylpent-1-en-3-yl)-2-methyl-4-[(4-methylphenyl)methyl]benzene.
| Compound Name | 1-(2,3-dimethylpent-1-en-3-yl)-2-methyl-4-[(4-methylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 145399611 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-(2,3-dimethylpent-1-en-3-yl)-2-methyl-4-[(4-methylphenyl)methyl]benzene |
| SMILES | C=C(C)C(C)(CC)c1ccc(Cc2ccc(C)cc2)cc1C |
| InChI | InChI=1S/C22H28/c1-7-22(6,16(2)3)21-13-12-20(14-18(21)5)15-19-10-8-17(4)9-11-19/h8-14H,2,7,15H2,1,3-6H3 |
| InChIKey | KBXOJLGLOCENHH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|