C32H45N — CID 143188287
N-(2,3-dimethylpent-1-en-3-yl)-4-methylaniline;ethane;1-methyl-4-(4-propylphenyl)benzene (PubChem CID 143188287) has the molecular formula C32H45N and a molecular weight of 443.72 g/mol. Its IUPAC name is N-(2,3-dimethylpent-1-en-3-yl)-4-methylaniline;ethane;1-methyl-4-(4-propylphenyl)benzene.
| Compound Name | N-(2,3-dimethylpent-1-en-3-yl)-4-methylaniline;ethane;1-methyl-4-(4-propylphenyl)benzene |
|---|---|
| PubChem CID | 143188287 |
| Molecular Formula | C32H45N |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.36 |
| IUPAC Name | N-(2,3-dimethylpent-1-en-3-yl)-4-methylaniline;ethane;1-methyl-4-(4-propylphenyl)benzene |
| SMILES | C=C(C)C(C)(CC)Nc1ccc(C)cc1.CC.CCCc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H18.C14H21N.C2H6/c1-3-4-14-7-11-16(12-8-14)15-9-5-13(2)6-10-15;1-6-14(5,11(2)3)15-13-9-7-12(4)8-10-13;1-2/h5-12H,3-4H2,1-2H3;7-10,15H,2,6H2,1,3-5H3;1-2H3 |
| InChIKey | PDCHANHZKROGFO-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|