C14H11N3O3 — CID 20564285
1-amino-6-methoxy-4,7-phenanthroline-3-carboxylic acid (PubChem CID 20564285) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-amino-6-methoxy-4,7-phenanthroline-3-carboxylic acid.
| Compound Name | 1-amino-6-methoxy-4,7-phenanthroline-3-carboxylic acid |
|---|---|
| PubChem CID | 20564285 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-amino-6-methoxy-4,7-phenanthroline-3-carboxylic acid |
| SMILES | COc1cc2nc(C(=O)O)cc(N)c2c2cccnc12 |
| InChI | InChI=1S/C14H11N3O3/c1-20-11-6-9-12(7-3-2-4-16-13(7)11)8(15)5-10(17-9)14(18)19/h2-6H,1H3,(H2,15,17)(H,18,19) |
| InChIKey | SOSCTKPRXBYVQD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|