C21H21Cl2NO2 — CID 20571380
(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboximidate (PubChem CID 20571380) has the molecular formula C21H21Cl2NO2 and a molecular weight of 390.31 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboximidate.
| Compound Name | (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboximidate |
|---|---|
| PubChem CID | 20571380 |
| Molecular Formula | C21H21Cl2NO2 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboximidate |
| SMILES | [H]/N=C(\OCc1cccc(Oc2ccccc2)c1)C1C(C=C(Cl)Cl)C1(C)C |
| InChI | InChI=1S/C21H21Cl2NO2/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19,24H,13H2,1-2H3/b24-20- |
| InChIKey | LTMASQIDMLMOTK-GFMRDNFCSA-N |
| XLogP | 6.56 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|