About 3-pentyl-oxacyclohexadecane-2,16-dione
3-pentyl-oxacyclohexadecane-2,16-dione (PubChem CID 20572463) has the molecular formula C20H36O3
and a molecular weight of 324.51 g/mol. Its IUPAC name is 3-pentyl-oxacyclohexadecane-2,16-dione.
Molecular Properties
| Compound Name | 3-pentyl-oxacyclohexadecane-2,16-dione |
| PubChem CID | 20572463 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 3-pentyl-oxacyclohexadecane-2,16-dione |
| SMILES | CCCCCC1CCCCCCCCCCCCC(=O)OC1=O |
| InChI | InChI=1S/C20H36O3/c1-2-3-12-15-18-16-13-10-8-6-4-5-7-9-11-14-17-19(21)23-20(18)22/h18H,2-17H2,1H3 |
| InChIKey | OLCXAQZIONOCNL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-oxacyclohexadecane-2,16-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-oxacyclohexadecane-2,16-dione?
The IUPAC name of 3-pentyl-oxacyclohexadecane-2,16-dione (CID 20572463) is 3-pentyl-oxacyclohexadecane-2,16-dione.
What is the SMILES notation for 3-pentyl-oxacyclohexadecane-2,16-dione?
The canonical SMILES for 3-pentyl-oxacyclohexadecane-2,16-dione is CCCCCC1CCCCCCCCCCCCC(=O)OC1=O.
What is the InChIKey of 3-pentyl-oxacyclohexadecane-2,16-dione?
The InChIKey is OLCXAQZIONOCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O3/c1-2-3-12-15-18-16-13-10-8-6-4-5-7-9-11-14-17-19(21)23-20(18)22/h18H,2-17H2,1H3.
What are the key properties of 3-pentyl-oxacyclohexadecane-2,16-dione?
3-pentyl-oxacyclohexadecane-2,16-dione has a molecular weight of 324.51 g/mol, XLogP of 5.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-oxacyclohexadecane-2,16-dione is sourced from PubChem (CID 20572463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).