C31H42O6 — CID 20576095
2,3-di(tetradeca-10,12-diynoyloxy)propanoic acid (PubChem CID 20576095) has the molecular formula C31H42O6 and a molecular weight of 510.67 g/mol. Its IUPAC name is 2,3-di(tetradeca-10,12-diynoyloxy)propanoic acid.
| Compound Name | 2,3-di(tetradeca-10,12-diynoyloxy)propanoic acid |
|---|---|
| PubChem CID | 20576095 |
| Molecular Formula | C31H42O6 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | 2,3-di(tetradeca-10,12-diynoyloxy)propanoic acid |
| SMILES | CC#CC#CCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCC#CC#CC)C(=O)O |
| InChI | InChI=1S/C31H42O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-29(32)36-27-28(31(34)35)37-30(33)26-24-22-20-18-16-14-12-10-8-6-4-2/h28H,11-27H2,1-2H3,(H,34,35) |
| InChIKey | JBKQNRMVTXKJQN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|