C26H42O6 — CID 20576858
[4-(7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl)-2-[(2-tert-butyl-4-methyl-5-oxo-1,3-dioxolan-4-yl)methyl]pentyl] acetate (PubChem CID 20576858) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is [4-(7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl)-2-[(2-tert-butyl-4-methyl-5-oxo-1,3-dioxolan-4-yl)methyl]pentyl] acetate.
| Compound Name | [4-(7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl)-2-[(2-tert-butyl-4-methyl-5-oxo-1,3-dioxolan-4-yl)methyl]pentyl] acetate |
|---|---|
| PubChem CID | 20576858 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | [4-(7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl)-2-[(2-tert-butyl-4-methyl-5-oxo-1,3-dioxolan-4-yl)methyl]pentyl] acetate |
| SMILES | CC(=O)OCC(CC(C)C1CCC2C(=O)CCCC21C)CC1(C)OC(C(C)(C)C)OC1=O |
| InChI | InChI=1S/C26H42O6/c1-16(19-10-11-20-21(28)9-8-12-25(19,20)6)13-18(15-30-17(2)27)14-26(7)22(29)31-23(32-26)24(3,4)5/h16,18-20,23H,8-15H2,1-7H3 |
| InChIKey | IIGNUWIPSRVNHI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |