C26H48O6 — CID 20577429
2-methoxy-3,5,6-trimethyl-4-[3,4,6-trimethyl-5-(3,4,5,6-tetramethyloxan-2-yl)oxyoxan-2-yl]oxyoxane (PubChem CID 20577429) has the molecular formula C26H48O6 and a molecular weight of 456.66 g/mol. Its IUPAC name is 2-methoxy-3,5,6-trimethyl-4-[3,4,6-trimethyl-5-(3,4,5,6-tetramethyloxan-2-yl)oxyoxan-2-yl]oxyoxane.
| Compound Name | 2-methoxy-3,5,6-trimethyl-4-[3,4,6-trimethyl-5-(3,4,5,6-tetramethyloxan-2-yl)oxyoxan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 20577429 |
| Molecular Formula | C26H48O6 |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | 2-methoxy-3,5,6-trimethyl-4-[3,4,6-trimethyl-5-(3,4,5,6-tetramethyloxan-2-yl)oxyoxan-2-yl]oxyoxane |
| SMILES | COC1OC(C)C(C)C(OC2OC(C)C(OC3OC(C)C(C)C(C)C3C)C(C)C2C)C1C |
| InChI | InChI=1S/C26H48O6/c1-12-13(2)19(8)29-25(15(12)4)32-23-14(3)16(5)26(30-21(23)10)31-22-17(6)20(9)28-24(27-11)18(22)7/h12-26H,1-11H3 |
| InChIKey | ICVHARBDUAZSBU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |