C24H27NO2 — CID 20580129
2-[4-(N-(3,4-dimethylphenyl)-3,4-dimethylanilino)phenoxy]ethanol (PubChem CID 20580129) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[4-(N-(3,4-dimethylphenyl)-3,4-dimethylanilino)phenoxy]ethanol.
| Compound Name | 2-[4-(N-(3,4-dimethylphenyl)-3,4-dimethylanilino)phenoxy]ethanol |
|---|---|
| PubChem CID | 20580129 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[4-(N-(3,4-dimethylphenyl)-3,4-dimethylanilino)phenoxy]ethanol |
| SMILES | Cc1ccc(N(c2ccc(OCCO)cc2)c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C24H27NO2/c1-17-5-7-22(15-19(17)3)25(23-8-6-18(2)20(4)16-23)21-9-11-24(12-10-21)27-14-13-26/h5-12,15-16,26H,13-14H2,1-4H3 |
| InChIKey | WHETXEGUKAFXHL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |