C36H35NO4 — CID 20580176
4-[2-(4-hydroxyphenyl)-4-[4-(4-methoxy-N-(3-methoxyphenyl)anilino)phenyl]butan-2-yl]phenol (PubChem CID 20580176) has the molecular formula C36H35NO4 and a molecular weight of 545.68 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)-4-[4-(4-methoxy-N-(3-methoxyphenyl)anilino)phenyl]butan-2-yl]phenol.
| Compound Name | 4-[2-(4-hydroxyphenyl)-4-[4-(4-methoxy-N-(3-methoxyphenyl)anilino)phenyl]butan-2-yl]phenol |
|---|---|
| PubChem CID | 20580176 |
| Molecular Formula | C36H35NO4 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)-4-[4-(4-methoxy-N-(3-methoxyphenyl)anilino)phenyl]butan-2-yl]phenol |
| SMILES | COc1ccc(N(c2ccc(CCC(C)(c3ccc(O)cc3)c3ccc(O)cc3)cc2)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C36H35NO4/c1-36(27-9-17-32(38)18-10-27,28-11-19-33(39)20-12-28)24-23-26-7-13-29(14-8-26)37(30-15-21-34(40-2)22-16-30)31-5-4-6-35(25-31)41-3/h4-22,25,38-39H,23-24H2,1-3H3 |
| InChIKey | GCLJQCFWKZOEIG-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |